1,1-difluoro-2-oxo-2-propan-2-yloxyethanesulfonic acid

C5H8F2O5S — CID 15152839

IUPAC1,1-difluoro-2-oxo-2-propan-2-yloxyethanesulfonic acid
SMILESCC(C)OC(=O)C(F)(F)S(=O)(=O)O
InChIInChI=1S/C5H8F2O5S/c1-3(2)12-4(8)5(6,7)13(9,10)11/h3H,1-2H3,(H,9,10,11)
InChIKeyINVQFSDLCUOZME-UHFFFAOYSA-N
MW218.18 g/mol
LogP0.42
Rot. Bonds3

About 1,1-difluoro-2-oxo-2-propan-2-yloxyethanesulfonic acid

1,1-difluoro-2-oxo-2-propan-2-yloxyethanesulfonic acid (PubChem CID 15152839) has the molecular formula C5H8F2O5S and a molecular weight of 218.18 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-propan-2-yloxyethanesulfonic acid.

Molecular Properties

Compound Name1,1-difluoro-2-oxo-2-propan-2-yloxyethanesulfonic acid
PubChem CID15152839
Molecular FormulaC5H8F2O5S
Molecular Weight218.18 g/mol
Exact Mass218.01
IUPAC Name1,1-difluoro-2-oxo-2-propan-2-yloxyethanesulfonic acid
SMILESCC(C)OC(=O)C(F)(F)S(=O)(=O)O
InChIInChI=1S/C5H8F2O5S/c1-3(2)12-4(8)5(6,7)13(9,10)11/h3H,1-2H3,(H,9,10,11)
InChIKeyINVQFSDLCUOZME-UHFFFAOYSA-N
XLogP0.42
TPSA80.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.18
LogP ≤ 50.42
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 1,1-difluoro-2-oxo-2-propan-2-yloxyethanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,1-difluoro-2-oxo-2-propan-2-yloxyethanesulfonic acid?
The IUPAC name of 1,1-difluoro-2-oxo-2-propan-2-yloxyethanesulfonic acid (CID 15152839) is 1,1-difluoro-2-oxo-2-propan-2-yloxyethanesulfonic acid.
What is the SMILES notation for 1,1-difluoro-2-oxo-2-propan-2-yloxyethanesulfonic acid?
The canonical SMILES for 1,1-difluoro-2-oxo-2-propan-2-yloxyethanesulfonic acid is CC(C)OC(=O)C(F)(F)S(=O)(=O)O.
What is the InChIKey of 1,1-difluoro-2-oxo-2-propan-2-yloxyethanesulfonic acid?
The InChIKey is INVQFSDLCUOZME-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8F2O5S/c1-3(2)12-4(8)5(6,7)13(9,10)11/h3H,1-2H3,(H,9,10,11).
What are the key properties of 1,1-difluoro-2-oxo-2-propan-2-yloxyethanesulfonic acid?
1,1-difluoro-2-oxo-2-propan-2-yloxyethanesulfonic acid has a molecular weight of 218.18 g/mol, XLogP of 0.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoro-2-oxo-2-propan-2-yloxyethanesulfonic acid is sourced from PubChem (CID 15152839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).