C17H36O2Si — CID 151528866
tert-butyl-[(3S,5S,6S)-5-methoxy-2,6-dimethyloct-7-en-3-yl]oxy-dimethylsilane (PubChem CID 151528866) has the molecular formula C17H36O2Si and a molecular weight of 300.56 g/mol. Its IUPAC name is tert-butyl-[(3S,5S,6S)-5-methoxy-2,6-dimethyloct-7-en-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(3S,5S,6S)-5-methoxy-2,6-dimethyloct-7-en-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 151528866 |
| Molecular Formula | C17H36O2Si |
| Molecular Weight | 300.56 g/mol |
| Exact Mass | 300.25 |
| IUPAC Name | tert-butyl-[(3S,5S,6S)-5-methoxy-2,6-dimethyloct-7-en-3-yl]oxy-dimethylsilane |
| SMILES | C=C[C@H](C)[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)C(C)C)OC |
| InChI | InChI=1S/C17H36O2Si/c1-11-14(4)16(18-8)12-15(13(2)3)19-20(9,10)17(5,6)7/h11,13-16H,1,12H2,2-10H3/t14-,15-,16-/m0/s1 |
| InChIKey | PWBAEZNZLDULJX-JYJNAYRXSA-N |
| XLogP | 5.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.56 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|