C19H43N3 — CID 151530221
1-N,1-N',1-N"-triethyl-1-N,1-N',1-N"-trimethyldecane-1,1,1-triamine (PubChem CID 151530221) has the molecular formula C19H43N3 and a molecular weight of 313.57 g/mol. Its IUPAC name is 1-N,1-N',1-N"-triethyl-1-N,1-N',1-N"-trimethyldecane-1,1,1-triamine.
| Compound Name | 1-N,1-N',1-N"-triethyl-1-N,1-N',1-N"-trimethyldecane-1,1,1-triamine |
|---|---|
| PubChem CID | 151530221 |
| Molecular Formula | C19H43N3 |
| Molecular Weight | 313.57 g/mol |
| Exact Mass | 313.35 |
| IUPAC Name | 1-N,1-N',1-N"-triethyl-1-N,1-N',1-N"-trimethyldecane-1,1,1-triamine |
| SMILES | CCCCCCCCCC(N(C)CC)(N(C)CC)N(C)CC |
| InChI | InChI=1S/C19H43N3/c1-8-12-13-14-15-16-17-18-19(20(5)9-2,21(6)10-3)22(7)11-4/h8-18H2,1-7H3 |
| InChIKey | PWHWQJVKQGRHHK-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.57 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|