About ethyl N-(2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate
ethyl N-(2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate (PubChem CID 15153061) has the molecular formula C17H18N4O2
and a molecular weight of 310.36 g/mol. Its IUPAC name is ethyl N-(2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate.
Molecular Properties
| Compound Name | ethyl N-(2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate |
| PubChem CID | 15153061 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | ethyl N-(2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate |
| SMILES | CCOC(=O)Nc1cc2c(cn1)N=C(c1ccccc1)C(C)N2 |
| InChI | InChI=1S/C17H18N4O2/c1-3-23-17(22)21-15-9-13-14(10-18-15)20-16(11(2)19-13)12-7-5-4-6-8-12/h4-11,19H,3H2,1-2H3,(H,18,21,22) |
| InChIKey | KXPVODQWULWSJW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl N-(2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate?
The IUPAC name of ethyl N-(2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate (CID 15153061) is ethyl N-(2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate.
What is the SMILES notation for ethyl N-(2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate?
The canonical SMILES for ethyl N-(2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate is CCOC(=O)Nc1cc2c(cn1)N=C(c1ccccc1)C(C)N2.
What is the InChIKey of ethyl N-(2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate?
The InChIKey is KXPVODQWULWSJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O2/c1-3-23-17(22)21-15-9-13-14(10-18-15)20-16(11(2)19-13)12-7-5-4-6-8-12/h4-11,19H,3H2,1-2H3,(H,18,21,22).
What are the key properties of ethyl N-(2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate?
ethyl N-(2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate has a molecular weight of 310.36 g/mol, XLogP of 3.58, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(2-methyl-3-phenyl-1,2-dihydropyrido[3,4-b]pyrazin-7-yl)carbamate is sourced from PubChem (CID 15153061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).