C75H49N5 — CID 151530880
9-[6-(3,6-diphenylcarbazol-9-yl)-4-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-2-pyridinyl]-3,6-diphenylcarbazole (PubChem CID 151530880) has the molecular formula C75H49N5 and a molecular weight of 1020.25 g/mol. Its IUPAC name is 9-[6-(3,6-diphenylcarbazol-9-yl)-4-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-2-pyridinyl]-3,6-diphenylcarbazole.
| Compound Name | 9-[6-(3,6-diphenylcarbazol-9-yl)-4-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-2-pyridinyl]-3,6-diphenylcarbazole |
|---|---|
| PubChem CID | 151530880 |
| Molecular Formula | C75H49N5 |
| Molecular Weight | 1020.25 g/mol |
| Exact Mass | 1019.40 |
| IUPAC Name | 9-[6-(3,6-diphenylcarbazol-9-yl)-4-[3-(2,6-diphenylpyrimidin-4-yl)phenyl]-2-pyridinyl]-3,6-diphenylcarbazole |
| SMILES | c1ccc(-c2ccc3c(c2)c2cc(-c4ccccc4)ccc2n3-c2cc(-c3cccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)c3)cc(-n3c4ccc(-c5ccccc5)cc4c4cc(-c5ccccc5)ccc43)n2)cc1 |
| InChI | InChI=1S/C75H49N5/c1-7-20-50(21-8-1)57-34-38-69-63(43-57)64-44-58(51-22-9-2-10-23-51)35-39-70(64)79(69)73-47-62(56-32-19-33-61(42-56)68-49-67(54-28-15-5-16-29-54)76-75(77-68)55-30-17-6-18-31-55)48-74(78-73)80-71-40-36-59(52-24-11-3-12-25-52)45-65(71)66-46-60(37-41-72(66)80)53-26-13-4-14-27-53/h1-49H |
| InChIKey | PWLAOIPAXQNVTI-UHFFFAOYSA-N |
| XLogP | 19.40 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1020.25 |
| LogP ≤ 5 | 19.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |