C29H29ClN8O3 — CID 151531003
7-(2-chloro-3,5-dimethoxyphenyl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine (PubChem CID 151531003) has the molecular formula C29H29ClN8O3 and a molecular weight of 573.06 g/mol. Its IUPAC name is 7-(2-chloro-3,5-dimethoxyphenyl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine.
| Compound Name | 7-(2-chloro-3,5-dimethoxyphenyl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
|---|---|
| PubChem CID | 151531003 |
| Molecular Formula | C29H29ClN8O3 |
| Molecular Weight | 573.06 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | 7-(2-chloro-3,5-dimethoxyphenyl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]-2,4,5,11,13-pentazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaen-12-amine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(Nc4ccc(N5CCN(C6COC6)CC5)cc4)nc3n3cnnc23)c1 |
| InChI | InChI=1S/C29H29ClN8O3/c1-39-22-12-23(26(30)25(13-22)40-2)24-11-18-14-31-29(34-27(18)38-17-32-35-28(24)38)33-19-3-5-20(6-4-19)36-7-9-37(10-8-36)21-15-41-16-21/h3-6,11-14,17,21H,7-10,15-16H2,1-2H3,(H,31,33,34) |
| InChIKey | PWLRBBGZMWSVCI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.06 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|