About 3,3-diethyl-1H-indol-2-one
3,3-diethyl-1H-indol-2-one (PubChem CID 15153221) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is 3,3-diethyl-1H-indol-2-one.
Molecular Properties
| Compound Name | 3,3-diethyl-1H-indol-2-one |
| PubChem CID | 15153221 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 3,3-diethyl-1H-indol-2-one |
| SMILES | CCC1(CC)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C12H15NO/c1-3-12(4-2)9-7-5-6-8-10(9)13-11(12)14/h5-8H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | JOAHCWIICCHHOU-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-diethyl-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethyl-1H-indol-2-one?
The IUPAC name of 3,3-diethyl-1H-indol-2-one (CID 15153221) is 3,3-diethyl-1H-indol-2-one.
What is the SMILES notation for 3,3-diethyl-1H-indol-2-one?
The canonical SMILES for 3,3-diethyl-1H-indol-2-one is CCC1(CC)C(=O)Nc2ccccc21.
What is the InChIKey of 3,3-diethyl-1H-indol-2-one?
The InChIKey is JOAHCWIICCHHOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO/c1-3-12(4-2)9-7-5-6-8-10(9)13-11(12)14/h5-8H,3-4H2,1-2H3,(H,13,14).
What are the key properties of 3,3-diethyl-1H-indol-2-one?
3,3-diethyl-1H-indol-2-one has a molecular weight of 189.26 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethyl-1H-indol-2-one is sourced from PubChem (CID 15153221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).