About 3,3-diethyl-1,2-dihydroindole
3,3-diethyl-1,2-dihydroindole (PubChem CID 15153225) has the molecular formula C12H17N
and a molecular weight of 175.28 g/mol. Its IUPAC name is 3,3-diethyl-1,2-dihydroindole.
Molecular Properties
| Compound Name | 3,3-diethyl-1,2-dihydroindole |
| PubChem CID | 15153225 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 3,3-diethyl-1,2-dihydroindole |
| SMILES | CCC1(CC)CNc2ccccc21 |
| InChI | InChI=1S/C12H17N/c1-3-12(4-2)9-13-11-8-6-5-7-10(11)12/h5-8,13H,3-4,9H2,1-2H3 |
| InChIKey | VSAJILQTDDOIET-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,3-diethyl-1,2-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethyl-1,2-dihydroindole?
The IUPAC name of 3,3-diethyl-1,2-dihydroindole (CID 15153225) is 3,3-diethyl-1,2-dihydroindole.
What is the SMILES notation for 3,3-diethyl-1,2-dihydroindole?
The canonical SMILES for 3,3-diethyl-1,2-dihydroindole is CCC1(CC)CNc2ccccc21.
What is the InChIKey of 3,3-diethyl-1,2-dihydroindole?
The InChIKey is VSAJILQTDDOIET-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c1-3-12(4-2)9-13-11-8-6-5-7-10(11)12/h5-8,13H,3-4,9H2,1-2H3.
What are the key properties of 3,3-diethyl-1,2-dihydroindole?
3,3-diethyl-1,2-dihydroindole has a molecular weight of 175.28 g/mol, XLogP of 3.17, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethyl-1,2-dihydroindole is sourced from PubChem (CID 15153225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).