C20H36O3 — CID 15153401
(2R,5R,6R)-2-cyclohexyl-6-methyl-5-nonyl-1,3-dioxan-4-one (PubChem CID 15153401) has the molecular formula C20H36O3 and a molecular weight of 324.51 g/mol. Its IUPAC name is (2R,5R,6R)-2-cyclohexyl-6-methyl-5-nonyl-1,3-dioxan-4-one.
| Compound Name | (2R,5R,6R)-2-cyclohexyl-6-methyl-5-nonyl-1,3-dioxan-4-one |
|---|---|
| PubChem CID | 15153401 |
| Molecular Formula | C20H36O3 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.27 |
| IUPAC Name | (2R,5R,6R)-2-cyclohexyl-6-methyl-5-nonyl-1,3-dioxan-4-one |
| SMILES | CCCCCCCCC[C@H]1C(=O)O[C@H](C2CCCCC2)O[C@@H]1C |
| InChI | InChI=1S/C20H36O3/c1-3-4-5-6-7-8-12-15-18-16(2)22-20(23-19(18)21)17-13-10-9-11-14-17/h16-18,20H,3-15H2,1-2H3/t16-,18-,20-/m1/s1 |
| InChIKey | LHIOTPIPLKPBSO-YVWKXTFCSA-N |
| XLogP | 5.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|