About 2-thiocyanatoethyl 2-[hydroxy(phenyl)methyl]prop-2-enoate
2-thiocyanatoethyl 2-[hydroxy(phenyl)methyl]prop-2-enoate (PubChem CID 15153830) has the molecular formula C13H13NO3S
and a molecular weight of 263.32 g/mol. Its IUPAC name is 2-thiocyanatoethyl 2-[hydroxy(phenyl)methyl]prop-2-enoate.
Molecular Properties
| Compound Name | 2-thiocyanatoethyl 2-[hydroxy(phenyl)methyl]prop-2-enoate |
| PubChem CID | 15153830 |
| Molecular Formula | C13H13NO3S |
| Molecular Weight | 263.32 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2-thiocyanatoethyl 2-[hydroxy(phenyl)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OCCSC#N)C(O)c1ccccc1 |
| InChI | InChI=1S/C13H13NO3S/c1-10(13(16)17-7-8-18-9-14)12(15)11-5-3-2-4-6-11/h2-6,12,15H,1,7-8H2 |
| InChIKey | RLBMLRYPMWABEY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-thiocyanatoethyl 2-[hydroxy(phenyl)methyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiocyanatoethyl 2-[hydroxy(phenyl)methyl]prop-2-enoate?
The IUPAC name of 2-thiocyanatoethyl 2-[hydroxy(phenyl)methyl]prop-2-enoate (CID 15153830) is 2-thiocyanatoethyl 2-[hydroxy(phenyl)methyl]prop-2-enoate.
What is the SMILES notation for 2-thiocyanatoethyl 2-[hydroxy(phenyl)methyl]prop-2-enoate?
The canonical SMILES for 2-thiocyanatoethyl 2-[hydroxy(phenyl)methyl]prop-2-enoate is C=C(C(=O)OCCSC#N)C(O)c1ccccc1.
What is the InChIKey of 2-thiocyanatoethyl 2-[hydroxy(phenyl)methyl]prop-2-enoate?
The InChIKey is RLBMLRYPMWABEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3S/c1-10(13(16)17-7-8-18-9-14)12(15)11-5-3-2-4-6-11/h2-6,12,15H,1,7-8H2.
What are the key properties of 2-thiocyanatoethyl 2-[hydroxy(phenyl)methyl]prop-2-enoate?
2-thiocyanatoethyl 2-[hydroxy(phenyl)methyl]prop-2-enoate has a molecular weight of 263.32 g/mol, XLogP of 2.03, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiocyanatoethyl 2-[hydroxy(phenyl)methyl]prop-2-enoate is sourced from PubChem (CID 15153830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).