C13H18O2S — CID 151540147
(1R,2R,6S)-3-methyl-6-[(1-methylidenethiophen-2-yl)methyl]cyclohex-3-ene-1,2-diol (PubChem CID 151540147) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is (1R,2R,6S)-3-methyl-6-[(1-methylidenethiophen-2-yl)methyl]cyclohex-3-ene-1,2-diol.
| Compound Name | (1R,2R,6S)-3-methyl-6-[(1-methylidenethiophen-2-yl)methyl]cyclohex-3-ene-1,2-diol |
|---|---|
| PubChem CID | 151540147 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (1R,2R,6S)-3-methyl-6-[(1-methylidenethiophen-2-yl)methyl]cyclohex-3-ene-1,2-diol |
| SMILES | C=S1C=CC=C1C[C@@H]1CC=C(C)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H18O2S/c1-9-5-6-10(13(15)12(9)14)8-11-4-3-7-16(11)2/h3-5,7,10,12-15H,2,6,8H2,1H3/t10-,12+,13+,16?/m0/s1 |
| InChIKey | PYHOGWJIHLAUNH-RTVKNMPLSA-N |
| XLogP | 2.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|