C21H27N — CID 151540812
2,3-dibutyl-9H-fluoren-1-amine (PubChem CID 151540812) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is 2,3-dibutyl-9H-fluoren-1-amine.
| Compound Name | 2,3-dibutyl-9H-fluoren-1-amine |
|---|---|
| PubChem CID | 151540812 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 2,3-dibutyl-9H-fluoren-1-amine |
| SMILES | CCCCc1cc2c(c(N)c1CCCC)Cc1ccccc1-2 |
| InChI | InChI=1S/C21H27N/c1-3-5-9-16-13-19-17-12-8-7-10-15(17)14-20(19)21(22)18(16)11-6-4-2/h7-8,10,12-13H,3-6,9,11,14,22H2,1-2H3 |
| InChIKey | PYLBDOKDVFADOB-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|