C19H16N2O2S — CID 15154109
1,1-dioxo-3,5-diphenylthiane-4,4-dicarbonitrile (PubChem CID 15154109) has the molecular formula C19H16N2O2S and a molecular weight of 336.42 g/mol. Its IUPAC name is 1,1-dioxo-3,5-diphenylthiane-4,4-dicarbonitrile.
| Compound Name | 1,1-dioxo-3,5-diphenylthiane-4,4-dicarbonitrile |
|---|---|
| PubChem CID | 15154109 |
| Molecular Formula | C19H16N2O2S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1,1-dioxo-3,5-diphenylthiane-4,4-dicarbonitrile |
| SMILES | N#CC1(C#N)C(c2ccccc2)CS(=O)(=O)CC1c1ccccc1 |
| InChI | InChI=1S/C19H16N2O2S/c20-13-19(14-21)17(15-7-3-1-4-8-15)11-24(22,23)12-18(19)16-9-5-2-6-10-16/h1-10,17-18H,11-12H2 |
| InChIKey | KNGIGNGORUAJLY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |