C21H20N2O2S — CID 15154110
3,5-bis(4-methylphenyl)-1,1-dioxothiane-4,4-dicarbonitrile (PubChem CID 15154110) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 3,5-bis(4-methylphenyl)-1,1-dioxothiane-4,4-dicarbonitrile.
| Compound Name | 3,5-bis(4-methylphenyl)-1,1-dioxothiane-4,4-dicarbonitrile |
|---|---|
| PubChem CID | 15154110 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 3,5-bis(4-methylphenyl)-1,1-dioxothiane-4,4-dicarbonitrile |
| SMILES | Cc1ccc(C2CS(=O)(=O)CC(c3ccc(C)cc3)C2(C#N)C#N)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-15-3-7-17(8-4-15)19-11-26(24,25)12-20(21(19,13-22)14-23)18-9-5-16(2)6-10-18/h3-10,19-20H,11-12H2,1-2H3 |
| InChIKey | ZVGVUQGJPZSHQO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |