About 3,5-dimethyl-1-naphthalen-1-yl-6-(2H-tetrazol-5-yl)pyrazolo[4,5-b]pyridine
3,5-dimethyl-1-naphthalen-1-yl-6-(2H-tetrazol-5-yl)pyrazolo[4,5-b]pyridine (PubChem CID 151541219) has the molecular formula C19H15N7
and a molecular weight of 341.38 g/mol. Its IUPAC name is 3,5-dimethyl-1-naphthalen-1-yl-6-(2H-tetrazol-5-yl)pyrazolo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 3,5-dimethyl-1-naphthalen-1-yl-6-(2H-tetrazol-5-yl)pyrazolo[4,5-b]pyridine |
| PubChem CID | 151541219 |
| Molecular Formula | C19H15N7 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 3,5-dimethyl-1-naphthalen-1-yl-6-(2H-tetrazol-5-yl)pyrazolo[4,5-b]pyridine |
| SMILES | Cc1nc2c(C)nn(-c3cccc4ccccc34)c2cc1-c1nn[nH]n1 |
| InChI | InChI=1S/C19H15N7/c1-11-15(19-21-24-25-22-19)10-17-18(20-11)12(2)23-26(17)16-9-5-7-13-6-3-4-8-14(13)16/h3-10H,1-2H3,(H,21,22,24,25) |
| InChIKey | PYNBZQBJOQAAPT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3,5-dimethyl-1-naphthalen-1-yl-6-(2H-tetrazol-5-yl)pyrazolo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1-naphthalen-1-yl-6-(2H-tetrazol-5-yl)pyrazolo[4,5-b]pyridine?
The IUPAC name of 3,5-dimethyl-1-naphthalen-1-yl-6-(2H-tetrazol-5-yl)pyrazolo[4,5-b]pyridine (CID 151541219) is 3,5-dimethyl-1-naphthalen-1-yl-6-(2H-tetrazol-5-yl)pyrazolo[4,5-b]pyridine.
What is the SMILES notation for 3,5-dimethyl-1-naphthalen-1-yl-6-(2H-tetrazol-5-yl)pyrazolo[4,5-b]pyridine?
The canonical SMILES for 3,5-dimethyl-1-naphthalen-1-yl-6-(2H-tetrazol-5-yl)pyrazolo[4,5-b]pyridine is Cc1nc2c(C)nn(-c3cccc4ccccc34)c2cc1-c1nn[nH]n1.
What is the InChIKey of 3,5-dimethyl-1-naphthalen-1-yl-6-(2H-tetrazol-5-yl)pyrazolo[4,5-b]pyridine?
The InChIKey is PYNBZQBJOQAAPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N7/c1-11-15(19-21-24-25-22-19)10-17-18(20-11)12(2)23-26(17)16-9-5-7-13-6-3-4-8-14(13)16/h3-10H,1-2H3,(H,21,22,24,25).
What are the key properties of 3,5-dimethyl-1-naphthalen-1-yl-6-(2H-tetrazol-5-yl)pyrazolo[4,5-b]pyridine?
3,5-dimethyl-1-naphthalen-1-yl-6-(2H-tetrazol-5-yl)pyrazolo[4,5-b]pyridine has a molecular weight of 341.38 g/mol, XLogP of 3.37, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1-naphthalen-1-yl-6-(2H-tetrazol-5-yl)pyrazolo[4,5-b]pyridine is sourced from PubChem (CID 151541219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).