C15H19NOS — CID 15154221
(3R,4R)-3-methyl-4-(phenylsulfanylmethyl)-1-prop-2-enylpyrrolidin-2-one (PubChem CID 15154221) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is (3R,4R)-3-methyl-4-(phenylsulfanylmethyl)-1-prop-2-enylpyrrolidin-2-one.
| Compound Name | (3R,4R)-3-methyl-4-(phenylsulfanylmethyl)-1-prop-2-enylpyrrolidin-2-one |
|---|---|
| PubChem CID | 15154221 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | (3R,4R)-3-methyl-4-(phenylsulfanylmethyl)-1-prop-2-enylpyrrolidin-2-one |
| SMILES | C=CCN1C[C@H](CSc2ccccc2)[C@@H](C)C1=O |
| InChI | InChI=1S/C15H19NOS/c1-3-9-16-10-13(12(2)15(16)17)11-18-14-7-5-4-6-8-14/h3-8,12-13H,1,9-11H2,2H3/t12-,13-/m1/s1 |
| InChIKey | DLESTLQJMFJRQA-CHWSQXEVSA-N |
| XLogP | 3.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|