About 4-(bromomethyl)-2,6-dichloro-3-ethylpyridine
4-(bromomethyl)-2,6-dichloro-3-ethylpyridine (PubChem CID 15154284) has the molecular formula C8H8BrCl2N
and a molecular weight of 268.97 g/mol. Its IUPAC name is 4-(bromomethyl)-2,6-dichloro-3-ethylpyridine.
Molecular Properties
| Compound Name | 4-(bromomethyl)-2,6-dichloro-3-ethylpyridine |
| PubChem CID | 15154284 |
| Molecular Formula | C8H8BrCl2N |
| Molecular Weight | 268.97 g/mol |
| Exact Mass | 266.92 |
| IUPAC Name | 4-(bromomethyl)-2,6-dichloro-3-ethylpyridine |
| SMILES | CCc1c(CBr)cc(Cl)nc1Cl |
| InChI | InChI=1S/C8H8BrCl2N/c1-2-6-5(4-9)3-7(10)12-8(6)11/h3H,2,4H2,1H3 |
| InChIKey | JCRAXFDNEPEBNQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.97 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)-2,6-dichloro-3-ethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)-2,6-dichloro-3-ethylpyridine?
The IUPAC name of 4-(bromomethyl)-2,6-dichloro-3-ethylpyridine (CID 15154284) is 4-(bromomethyl)-2,6-dichloro-3-ethylpyridine.
What is the SMILES notation for 4-(bromomethyl)-2,6-dichloro-3-ethylpyridine?
The canonical SMILES for 4-(bromomethyl)-2,6-dichloro-3-ethylpyridine is CCc1c(CBr)cc(Cl)nc1Cl.
What is the InChIKey of 4-(bromomethyl)-2,6-dichloro-3-ethylpyridine?
The InChIKey is JCRAXFDNEPEBNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrCl2N/c1-2-6-5(4-9)3-7(10)12-8(6)11/h3H,2,4H2,1H3.
What are the key properties of 4-(bromomethyl)-2,6-dichloro-3-ethylpyridine?
4-(bromomethyl)-2,6-dichloro-3-ethylpyridine has a molecular weight of 268.97 g/mol, XLogP of 3.85, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)-2,6-dichloro-3-ethylpyridine is sourced from PubChem (CID 15154284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).