C24H22N6O2 — CID 151546137
N-(3-imidazol-1-ylpropyl)-6-(2-methoxyphenyl)-3-(1,3,4-oxadiazol-2-yl)quinolin-4-amine (PubChem CID 151546137) has the molecular formula C24H22N6O2 and a molecular weight of 426.48 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-6-(2-methoxyphenyl)-3-(1,3,4-oxadiazol-2-yl)quinolin-4-amine.
| Compound Name | N-(3-imidazol-1-ylpropyl)-6-(2-methoxyphenyl)-3-(1,3,4-oxadiazol-2-yl)quinolin-4-amine |
|---|---|
| PubChem CID | 151546137 |
| Molecular Formula | C24H22N6O2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-6-(2-methoxyphenyl)-3-(1,3,4-oxadiazol-2-yl)quinolin-4-amine |
| SMILES | COc1ccccc1-c1ccc2ncc(-c3nnco3)c(NCCCn3ccnc3)c2c1 |
| InChI | InChI=1S/C24H22N6O2/c1-31-22-6-3-2-5-18(22)17-7-8-21-19(13-17)23(20(14-27-21)24-29-28-16-32-24)26-9-4-11-30-12-10-25-15-30/h2-3,5-8,10,12-16H,4,9,11H2,1H3,(H,26,27) |
| InChIKey | PZMRDXXERDRTRT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 90.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|