C9H15O4P — CID 151547350
(2,4,4-trimethylcyclohexa-1,5-dien-1-yl) dihydrogen phosphate (PubChem CID 151547350) has the molecular formula C9H15O4P and a molecular weight of 218.19 g/mol. Its IUPAC name is (2,4,4-trimethylcyclohexa-1,5-dien-1-yl) dihydrogen phosphate.
| Compound Name | (2,4,4-trimethylcyclohexa-1,5-dien-1-yl) dihydrogen phosphate |
|---|---|
| PubChem CID | 151547350 |
| Molecular Formula | C9H15O4P |
| Molecular Weight | 218.19 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | (2,4,4-trimethylcyclohexa-1,5-dien-1-yl) dihydrogen phosphate |
| SMILES | CC1=C(OP(=O)(O)O)C=CC(C)(C)C1 |
| InChI | InChI=1S/C9H15O4P/c1-7-6-9(2,3)5-4-8(7)13-14(10,11)12/h4-5H,6H2,1-3H3,(H2,10,11,12) |
| InChIKey | PZSVRACXYOBRHQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.19 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|