C17H10F12N2O3 — CID 151549649
3-amino-5-[2-[4-amino-3-hydroxy-5-(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-(trifluoromethyl)benzene-1,2-diol (PubChem CID 151549649) has the molecular formula C17H10F12N2O3 and a molecular weight of 518.25 g/mol. Its IUPAC name is 3-amino-5-[2-[4-amino-3-hydroxy-5-(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-(trifluoromethyl)benzene-1,2-diol.
| Compound Name | 3-amino-5-[2-[4-amino-3-hydroxy-5-(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-(trifluoromethyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 151549649 |
| Molecular Formula | C17H10F12N2O3 |
| Molecular Weight | 518.25 g/mol |
| Exact Mass | 518.05 |
| IUPAC Name | 3-amino-5-[2-[4-amino-3-hydroxy-5-(trifluoromethyl)phenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-4-(trifluoromethyl)benzene-1,2-diol |
| SMILES | Nc1c(O)cc(C(c2cc(O)c(O)c(N)c2C(F)(F)F)(C(F)(F)F)C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C17H10F12N2O3/c18-14(19,20)6-1-4(2-7(32)10(6)30)13(16(24,25)26,17(27,28)29)5-3-8(33)12(34)11(31)9(5)15(21,22)23/h1-3,32-34H,30-31H2 |
| InChIKey | QAEWGOALLMATQU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.25 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|