About bis[3-(2-bromo-3,5-dimethylphenyl)-2-pyridinyl]methanone
bis[3-(2-bromo-3,5-dimethylphenyl)-2-pyridinyl]methanone (PubChem CID 151549853) has the molecular formula C27H22Br2N2O
and a molecular weight of 550.29 g/mol. Its IUPAC name is bis[3-(2-bromo-3,5-dimethylphenyl)-2-pyridinyl]methanone.
Molecular Properties
| Compound Name | bis[3-(2-bromo-3,5-dimethylphenyl)-2-pyridinyl]methanone |
| PubChem CID | 151549853 |
| Molecular Formula | C27H22Br2N2O |
| Molecular Weight | 550.29 g/mol |
| Exact Mass | 548.01 |
| IUPAC Name | bis[3-(2-bromo-3,5-dimethylphenyl)-2-pyridinyl]methanone |
| SMILES | Cc1cc(C)c(Br)c(-c2cccnc2C(=O)c2ncccc2-c2cc(C)cc(C)c2Br)c1 |
| InChI | InChI=1S/C27H22Br2N2O/c1-15-11-17(3)23(28)21(13-15)19-7-5-9-30-25(19)27(32)26-20(8-6-10-31-26)22-14-16(2)12-18(4)24(22)29/h5-14H,1-4H3 |
| InChIKey | QAGBFBGMUQVPDD-UHFFFAOYSA-N |
| XLogP | 7.80 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.29 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bis[3-(2-bromo-3,5-dimethylphenyl)-2-pyridinyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[3-(2-bromo-3,5-dimethylphenyl)-2-pyridinyl]methanone?
The IUPAC name of bis[3-(2-bromo-3,5-dimethylphenyl)-2-pyridinyl]methanone (CID 151549853) is bis[3-(2-bromo-3,5-dimethylphenyl)-2-pyridinyl]methanone.
What is the SMILES notation for bis[3-(2-bromo-3,5-dimethylphenyl)-2-pyridinyl]methanone?
The canonical SMILES for bis[3-(2-bromo-3,5-dimethylphenyl)-2-pyridinyl]methanone is Cc1cc(C)c(Br)c(-c2cccnc2C(=O)c2ncccc2-c2cc(C)cc(C)c2Br)c1.
What is the InChIKey of bis[3-(2-bromo-3,5-dimethylphenyl)-2-pyridinyl]methanone?
The InChIKey is QAGBFBGMUQVPDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22Br2N2O/c1-15-11-17(3)23(28)21(13-15)19-7-5-9-30-25(19)27(32)26-20(8-6-10-31-26)22-14-16(2)12-18(4)24(22)29/h5-14H,1-4H3.
What are the key properties of bis[3-(2-bromo-3,5-dimethylphenyl)-2-pyridinyl]methanone?
bis[3-(2-bromo-3,5-dimethylphenyl)-2-pyridinyl]methanone has a molecular weight of 550.29 g/mol, XLogP of 7.80, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis[3-(2-bromo-3,5-dimethylphenyl)-2-pyridinyl]methanone is sourced from PubChem (CID 151549853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).