About propan-2-yl N-diazocarbamate
propan-2-yl N-diazocarbamate (PubChem CID 15155146) has the molecular formula C4H7N3O2
and a molecular weight of 129.12 g/mol. Its IUPAC name is propan-2-yl N-diazocarbamate.
Molecular Properties
| Compound Name | propan-2-yl N-diazocarbamate |
| PubChem CID | 15155146 |
| Molecular Formula | C4H7N3O2 |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | propan-2-yl N-diazocarbamate |
| SMILES | CC(C)OC(=O)N=[N+]=[N-] |
| InChI | InChI=1S/C4H7N3O2/c1-3(2)9-4(8)6-7-5/h3H,1-2H3 |
| InChIKey | FYVYLSOHKMRKDT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl N-diazocarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-diazocarbamate?
The IUPAC name of propan-2-yl N-diazocarbamate (CID 15155146) is propan-2-yl N-diazocarbamate.
What is the SMILES notation for propan-2-yl N-diazocarbamate?
The canonical SMILES for propan-2-yl N-diazocarbamate is CC(C)OC(=O)N=[N+]=[N-].
What is the InChIKey of propan-2-yl N-diazocarbamate?
The InChIKey is FYVYLSOHKMRKDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3O2/c1-3(2)9-4(8)6-7-5/h3H,1-2H3.
What are the key properties of propan-2-yl N-diazocarbamate?
propan-2-yl N-diazocarbamate has a molecular weight of 129.12 g/mol, XLogP of 1.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-diazocarbamate is sourced from PubChem (CID 15155146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).