C11H5F8N — CID 15155243
2,2,3,3,4,4,5,5-octafluoro-6-phenylpyridine (PubChem CID 15155243) has the molecular formula C11H5F8N and a molecular weight of 303.15 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoro-6-phenylpyridine.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoro-6-phenylpyridine |
|---|---|
| PubChem CID | 15155243 |
| Molecular Formula | C11H5F8N |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoro-6-phenylpyridine |
| SMILES | FC1(F)N=C(c2ccccc2)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H5F8N/c12-8(13)7(6-4-2-1-3-5-6)20-11(18,19)10(16,17)9(8,14)15/h1-5H |
| InChIKey | FIBNYJGNZYWHQR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|