C18H13Cl2F3N2O4 — CID 151553471
3-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-nitrobenzoic acid (PubChem CID 151553471) has the molecular formula C18H13Cl2F3N2O4 and a molecular weight of 449.21 g/mol. Its IUPAC name is 3-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-nitrobenzoic acid.
| Compound Name | 3-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 151553471 |
| Molecular Formula | C18H13Cl2F3N2O4 |
| Molecular Weight | 449.21 g/mol |
| Exact Mass | 448.02 |
| IUPAC Name | 3-[3-(3,5-dichlorophenyl)-3-(trifluoromethyl)pyrrolidin-1-yl]-2-nitrobenzoic acid |
| SMILES | O=C(O)c1cccc(N2CCC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H13Cl2F3N2O4/c19-11-6-10(7-12(20)8-11)17(18(21,22)23)4-5-24(9-17)14-3-1-2-13(16(26)27)15(14)25(28)29/h1-3,6-8H,4-5,9H2,(H,26,27) |
| InChIKey | QAZDOFGSCHGSRI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.21 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|