C28H30I6N2O10 — CID 151553836
3-[3-[2-[2-[2-[3-(3-carboxy-2,4,6-triiodo-N-methylanilino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoyl-methylamino]-2,4,6-triiodobenzoic acid (PubChem CID 151553836) has the molecular formula C28H30I6N2O10 and a molecular weight of 1315.98 g/mol. Its IUPAC name is 3-[3-[2-[2-[2-[3-(3-carboxy-2,4,6-triiodo-N-methylanilino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoyl-methylamino]-2,4,6-triiodobenzoic acid.
| Compound Name | 3-[3-[2-[2-[2-[3-(3-carboxy-2,4,6-triiodo-N-methylanilino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoyl-methylamino]-2,4,6-triiodobenzoic acid |
|---|---|
| PubChem CID | 151553836 |
| Molecular Formula | C28H30I6N2O10 |
| Molecular Weight | 1315.98 g/mol |
| Exact Mass | 1315.62 |
| IUPAC Name | 3-[3-[2-[2-[2-[3-(3-carboxy-2,4,6-triiodo-N-methylanilino)-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoyl-methylamino]-2,4,6-triiodobenzoic acid |
| SMILES | CN(C(=O)CCOCCOCCOCCOCCC(=O)N(C)c1c(I)cc(I)c(C(=O)O)c1I)c1c(I)cc(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C28H30I6N2O10/c1-35(25-17(31)13-15(29)21(23(25)33)27(39)40)19(37)3-5-43-7-9-45-11-12-46-10-8-44-6-4-20(38)36(2)26-18(32)14-16(30)22(24(26)34)28(41)42/h13-14H,3-12H2,1-2H3,(H,39,40)(H,41,42) |
| InChIKey | QBAZTYJRVAVSHK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 152.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1315.98 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|