C17H24N6O3S — CID 15155387
5-amino-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-morpholin-4-yl-1,2,4-triazole-1-carbothioamide (PubChem CID 15155387) has the molecular formula C17H24N6O3S and a molecular weight of 392.49 g/mol. Its IUPAC name is 5-amino-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-morpholin-4-yl-1,2,4-triazole-1-carbothioamide.
| Compound Name | 5-amino-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-morpholin-4-yl-1,2,4-triazole-1-carbothioamide |
|---|---|
| PubChem CID | 15155387 |
| Molecular Formula | C17H24N6O3S |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 5-amino-N-[2-(3,4-dimethoxyphenyl)ethyl]-3-morpholin-4-yl-1,2,4-triazole-1-carbothioamide |
| SMILES | COc1ccc(CCNC(=S)n2nc(N3CCOCC3)nc2N)cc1OC |
| InChI | InChI=1S/C17H24N6O3S/c1-24-13-4-3-12(11-14(13)25-2)5-6-19-17(27)23-15(18)20-16(21-23)22-7-9-26-10-8-22/h3-4,11H,5-10H2,1-2H3,(H,19,27)(H2,18,20,21) |
| InChIKey | UDOIZEDUINELSI-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|