C22H33N7O2S — CID 15155395
5-amino-3-morpholin-4-yl-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,4-triazole-1-carbothioamide (PubChem CID 15155395) has the molecular formula C22H33N7O2S and a molecular weight of 459.62 g/mol. Its IUPAC name is 5-amino-3-morpholin-4-yl-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,4-triazole-1-carbothioamide.
| Compound Name | 5-amino-3-morpholin-4-yl-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,4-triazole-1-carbothioamide |
|---|---|
| PubChem CID | 15155395 |
| Molecular Formula | C22H33N7O2S |
| Molecular Weight | 459.62 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 5-amino-3-morpholin-4-yl-N-[3-[3-(piperidin-1-ylmethyl)phenoxy]propyl]-1,2,4-triazole-1-carbothioamide |
| SMILES | Nc1nc(N2CCOCC2)nn1C(=S)NCCCOc1cccc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C22H33N7O2S/c23-20-25-21(28-11-14-30-15-12-28)26-29(20)22(32)24-8-5-13-31-19-7-4-6-18(16-19)17-27-9-2-1-3-10-27/h4,6-7,16H,1-3,5,8-15,17H2,(H,24,32)(H2,23,25,26) |
| InChIKey | VGNVEDRFMJPIPA-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.62 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|