C25H23FN6O — CID 151555820
[(1S,8R)-5-(3-fluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1-phenyl-1,2,4-triazol-3-yl)methanone (PubChem CID 151555820) has the molecular formula C25H23FN6O and a molecular weight of 442.50 g/mol. Its IUPAC name is [(1S,8R)-5-(3-fluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1-phenyl-1,2,4-triazol-3-yl)methanone.
| Compound Name | [(1S,8R)-5-(3-fluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1-phenyl-1,2,4-triazol-3-yl)methanone |
|---|---|
| PubChem CID | 151555820 |
| Molecular Formula | C25H23FN6O |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | [(1S,8R)-5-(3-fluorophenyl)-4-methyl-3,4,12-triazatricyclo[6.3.1.02,6]dodeca-2,5-dien-12-yl]-(1-phenyl-1,2,4-triazol-3-yl)methanone |
| SMILES | Cn1nc2c(c1-c1cccc(F)c1)C[C@H]1CCC[C@@H]2N1C(=O)c1ncn(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H23FN6O/c1-30-23(16-7-5-8-17(26)13-16)20-14-19-11-6-12-21(22(20)28-30)32(19)25(33)24-27-15-31(29-24)18-9-3-2-4-10-18/h2-5,7-10,13,15,19,21H,6,11-12,14H2,1H3/t19-,21+/m1/s1 |
| InChIKey | QBLGRFBMMPNLBT-CTNGQTDRSA-N |
| XLogP | 4.10 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |