C22H34O8 — CID 15156020
tetraethyl 2-methylidene-3-propylcyclohexane-1,1,4,4-tetracarboxylate (PubChem CID 15156020) has the molecular formula C22H34O8 and a molecular weight of 426.51 g/mol. Its IUPAC name is tetraethyl 2-methylidene-3-propylcyclohexane-1,1,4,4-tetracarboxylate.
| Compound Name | tetraethyl 2-methylidene-3-propylcyclohexane-1,1,4,4-tetracarboxylate |
|---|---|
| PubChem CID | 15156020 |
| Molecular Formula | C22H34O8 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | tetraethyl 2-methylidene-3-propylcyclohexane-1,1,4,4-tetracarboxylate |
| SMILES | C=C1C(CCC)C(C(=O)OCC)(C(=O)OCC)CCC1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C22H34O8/c1-7-12-16-15(6)21(17(23)27-8-2,18(24)28-9-3)13-14-22(16,19(25)29-10-4)20(26)30-11-5/h16H,6-14H2,1-5H3 |
| InChIKey | QQKJROVVZPIABV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|