C23H36O8 — CID 15156021
tetraethyl 2-butyl-3-methylidenecyclohexane-1,1,4,4-tetracarboxylate (PubChem CID 15156021) has the molecular formula C23H36O8 and a molecular weight of 440.53 g/mol. Its IUPAC name is tetraethyl 2-butyl-3-methylidenecyclohexane-1,1,4,4-tetracarboxylate.
| Compound Name | tetraethyl 2-butyl-3-methylidenecyclohexane-1,1,4,4-tetracarboxylate |
|---|---|
| PubChem CID | 15156021 |
| Molecular Formula | C23H36O8 |
| Molecular Weight | 440.53 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | tetraethyl 2-butyl-3-methylidenecyclohexane-1,1,4,4-tetracarboxylate |
| SMILES | C=C1C(CCCC)C(C(=O)OCC)(C(=O)OCC)CCC1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C23H36O8/c1-7-12-13-17-16(6)22(18(24)28-8-2,19(25)29-9-3)14-15-23(17,20(26)30-10-4)21(27)31-11-5/h17H,6-15H2,1-5H3 |
| InChIKey | ZAERMKJHUSEXOD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.53 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|