C26H42O8 — CID 15156022
tetraethyl 2-heptyl-3-methylidenecyclohexane-1,1,4,4-tetracarboxylate (PubChem CID 15156022) has the molecular formula C26H42O8 and a molecular weight of 482.61 g/mol. Its IUPAC name is tetraethyl 2-heptyl-3-methylidenecyclohexane-1,1,4,4-tetracarboxylate.
| Compound Name | tetraethyl 2-heptyl-3-methylidenecyclohexane-1,1,4,4-tetracarboxylate |
|---|---|
| PubChem CID | 15156022 |
| Molecular Formula | C26H42O8 |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | tetraethyl 2-heptyl-3-methylidenecyclohexane-1,1,4,4-tetracarboxylate |
| SMILES | C=C1C(CCCCCCC)C(C(=O)OCC)(C(=O)OCC)CCC1(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C26H42O8/c1-7-12-13-14-15-16-20-19(6)25(21(27)31-8-2,22(28)32-9-3)17-18-26(20,23(29)33-10-4)24(30)34-11-5/h20H,6-18H2,1-5H3 |
| InChIKey | VVEYNSXPDVEVHH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|