About 2-(2-hydroxyethoxy)-3,5-dimethylbenzonitrile
2-(2-hydroxyethoxy)-3,5-dimethylbenzonitrile (PubChem CID 151560499) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)-3,5-dimethylbenzonitrile.
Molecular Properties
| Compound Name | 2-(2-hydroxyethoxy)-3,5-dimethylbenzonitrile |
| PubChem CID | 151560499 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 2-(2-hydroxyethoxy)-3,5-dimethylbenzonitrile |
| SMILES | Cc1cc(C)c(OCCO)c(C#N)c1 |
| InChI | InChI=1S/C11H13NO2/c1-8-5-9(2)11(14-4-3-13)10(6-8)7-12/h5-6,13H,3-4H2,1-2H3 |
| InChIKey | QCIWERVYRGIXKH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-hydroxyethoxy)-3,5-dimethylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethoxy)-3,5-dimethylbenzonitrile?
The IUPAC name of 2-(2-hydroxyethoxy)-3,5-dimethylbenzonitrile (CID 151560499) is 2-(2-hydroxyethoxy)-3,5-dimethylbenzonitrile.
What is the SMILES notation for 2-(2-hydroxyethoxy)-3,5-dimethylbenzonitrile?
The canonical SMILES for 2-(2-hydroxyethoxy)-3,5-dimethylbenzonitrile is Cc1cc(C)c(OCCO)c(C#N)c1.
What is the InChIKey of 2-(2-hydroxyethoxy)-3,5-dimethylbenzonitrile?
The InChIKey is QCIWERVYRGIXKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-8-5-9(2)11(14-4-3-13)10(6-8)7-12/h5-6,13H,3-4H2,1-2H3.
What are the key properties of 2-(2-hydroxyethoxy)-3,5-dimethylbenzonitrile?
2-(2-hydroxyethoxy)-3,5-dimethylbenzonitrile has a molecular weight of 191.23 g/mol, XLogP of 1.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethoxy)-3,5-dimethylbenzonitrile is sourced from PubChem (CID 151560499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).