C18H22BFN4O2 — CID 151562581
4-fluoro-1-methyl-3-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 151562581) has the molecular formula C18H22BFN4O2 and a molecular weight of 356.21 g/mol. Its IUPAC name is 4-fluoro-1-methyl-3-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 4-fluoro-1-methyl-3-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 151562581 |
| Molecular Formula | C18H22BFN4O2 |
| Molecular Weight | 356.21 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 4-fluoro-1-methyl-3-(1-methylpyrazol-4-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | Cn1cc(-c2nn(C)c3ccc(B4OC(C)(C)C(C)(C)O4)c(F)c23)cn1 |
| InChI | InChI=1S/C18H22BFN4O2/c1-17(2)18(3,4)26-19(25-17)12-7-8-13-14(15(12)20)16(22-24(13)6)11-9-21-23(5)10-11/h7-10H,1-6H3 |
| InChIKey | QCTTYSMPSXUSBW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 54.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|