C14H13ClF6N6 — CID 151563639
6-(6-chloro-3,4,5-trideuterio-2-pyridinyl)-4-N-[(2R)-1,1,1-trideuterio-3,3,3-trifluoropropan-2-yl]-2-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine (PubChem CID 151563639) has the molecular formula C14H13ClF6N6 and a molecular weight of 420.78 g/mol. Its IUPAC name is 6-(6-chloro-3,4,5-trideuterio-2-pyridinyl)-4-N-[(2R)-1,1,1-trideuterio-3,3,3-trifluoropropan-2-yl]-2-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(6-chloro-3,4,5-trideuterio-2-pyridinyl)-4-N-[(2R)-1,1,1-trideuterio-3,3,3-trifluoropropan-2-yl]-2-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 151563639 |
| Molecular Formula | C14H13ClF6N6 |
| Molecular Weight | 420.78 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 6-(6-chloro-3,4,5-trideuterio-2-pyridinyl)-4-N-[(2R)-1,1,1-trideuterio-3,3,3-trifluoropropan-2-yl]-2-N-[(2R)-1,1,1-trifluoropropan-2-yl]-1,3,5-triazine-2,4-diamine |
| SMILES | [2H]c1c(Cl)nc(-c2nc(N[C@H](C([2H])([2H])[2H])C(F)(F)F)nc(N[C@H](C)C(F)(F)F)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C14H13ClF6N6/c1-6(13(16,17)18)22-11-25-10(8-4-3-5-9(15)24-8)26-12(27-11)23-7(2)14(19,20)21/h3-7H,1-2H3,(H2,22,23,25,26,27)/t6-,7-/m1/s1/i1D3,3D,4D,5D |
| InChIKey | QCZAWDGAVJMPTA-RMIHAKJHSA-N |
| XLogP | 4.31 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.78 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|