C25H26F2N2O4 — CID 151563898
1-(cyclopropylmethyl)-N-[(2,4-difluorophenyl)methyl]-6-hydroxy-5,7-dioxo-3,4,4a,6,10,10a-hexahydro-2H-benzo[g]quinoline-8-carboxamide (PubChem CID 151563898) has the molecular formula C25H26F2N2O4 and a molecular weight of 456.49 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-N-[(2,4-difluorophenyl)methyl]-6-hydroxy-5,7-dioxo-3,4,4a,6,10,10a-hexahydro-2H-benzo[g]quinoline-8-carboxamide.
| Compound Name | 1-(cyclopropylmethyl)-N-[(2,4-difluorophenyl)methyl]-6-hydroxy-5,7-dioxo-3,4,4a,6,10,10a-hexahydro-2H-benzo[g]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 151563898 |
| Molecular Formula | C25H26F2N2O4 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 1-(cyclopropylmethyl)-N-[(2,4-difluorophenyl)methyl]-6-hydroxy-5,7-dioxo-3,4,4a,6,10,10a-hexahydro-2H-benzo[g]quinoline-8-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)C1=CC2=C(C(=O)C3CCCN(CC4CC4)C3C2)C(O)C1=O |
| InChI | InChI=1S/C25H26F2N2O4/c26-16-6-5-14(19(27)10-16)11-28-25(33)18-8-15-9-20-17(22(30)21(15)24(32)23(18)31)2-1-7-29(20)12-13-3-4-13/h5-6,8,10,13,17,20,24,32H,1-4,7,9,11-12H2,(H,28,33) |
| InChIKey | QDAGGTVECGFJKN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|