About 5-(diethylamino)pentyl 2-cyclohexyl-2-phenylpropanoate
5-(diethylamino)pentyl 2-cyclohexyl-2-phenylpropanoate (PubChem CID 15157141) has the molecular formula C24H39NO2
and a molecular weight of 373.58 g/mol. Its IUPAC name is 5-(diethylamino)pentyl 2-cyclohexyl-2-phenylpropanoate.
Molecular Properties
| Compound Name | 5-(diethylamino)pentyl 2-cyclohexyl-2-phenylpropanoate |
| PubChem CID | 15157141 |
| Molecular Formula | C24H39NO2 |
| Molecular Weight | 373.58 g/mol |
| Exact Mass | 373.30 |
| IUPAC Name | 5-(diethylamino)pentyl 2-cyclohexyl-2-phenylpropanoate |
| SMILES | CCN(CC)CCCCCOC(=O)C(C)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C24H39NO2/c1-4-25(5-2)19-13-8-14-20-27-23(26)24(3,21-15-9-6-10-16-21)22-17-11-7-12-18-22/h6,9-10,15-16,22H,4-5,7-8,11-14,17-20H2,1-3H3 |
| InChIKey | SHORJVPMMAZEFL-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.58 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(diethylamino)pentyl 2-cyclohexyl-2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(diethylamino)pentyl 2-cyclohexyl-2-phenylpropanoate?
The IUPAC name of 5-(diethylamino)pentyl 2-cyclohexyl-2-phenylpropanoate (CID 15157141) is 5-(diethylamino)pentyl 2-cyclohexyl-2-phenylpropanoate.
What is the SMILES notation for 5-(diethylamino)pentyl 2-cyclohexyl-2-phenylpropanoate?
The canonical SMILES for 5-(diethylamino)pentyl 2-cyclohexyl-2-phenylpropanoate is CCN(CC)CCCCCOC(=O)C(C)(c1ccccc1)C1CCCCC1.
What is the InChIKey of 5-(diethylamino)pentyl 2-cyclohexyl-2-phenylpropanoate?
The InChIKey is SHORJVPMMAZEFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H39NO2/c1-4-25(5-2)19-13-8-14-20-27-23(26)24(3,21-15-9-6-10-16-21)22-17-11-7-12-18-22/h6,9-10,15-16,22H,4-5,7-8,11-14,17-20H2,1-3H3.
What are the key properties of 5-(diethylamino)pentyl 2-cyclohexyl-2-phenylpropanoate?
5-(diethylamino)pentyl 2-cyclohexyl-2-phenylpropanoate has a molecular weight of 373.58 g/mol, XLogP of 5.58, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(diethylamino)pentyl 2-cyclohexyl-2-phenylpropanoate is sourced from PubChem (CID 15157141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).