C28H36N6O2 — CID 151572744
8-propan-2-yl-2-[[(1S)-1-[4-[(1R)-1-(4-prop-2-enoylpiperazin-1-yl)propyl]phenyl]ethyl]amino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 151572744) has the molecular formula C28H36N6O2 and a molecular weight of 488.64 g/mol. Its IUPAC name is 8-propan-2-yl-2-[[(1S)-1-[4-[(1R)-1-(4-prop-2-enoylpiperazin-1-yl)propyl]phenyl]ethyl]amino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-propan-2-yl-2-[[(1S)-1-[4-[(1R)-1-(4-prop-2-enoylpiperazin-1-yl)propyl]phenyl]ethyl]amino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 151572744 |
| Molecular Formula | C28H36N6O2 |
| Molecular Weight | 488.64 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 8-propan-2-yl-2-[[(1S)-1-[4-[(1R)-1-(4-prop-2-enoylpiperazin-1-yl)propyl]phenyl]ethyl]amino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | C=CC(=O)N1CCN([C@H](CC)c2ccc([C@H](C)Nc3ncc4ccc(=O)n(C(C)C)c4n3)cc2)CC1 |
| InChI | InChI=1S/C28H36N6O2/c1-6-24(32-14-16-33(17-15-32)25(35)7-2)22-10-8-21(9-11-22)20(5)30-28-29-18-23-12-13-26(36)34(19(3)4)27(23)31-28/h7-13,18-20,24H,2,6,14-17H2,1,3-5H3,(H,29,30,31)/t20-,24+/m0/s1 |
| InChIKey | QEUJFCJJKZMAHH-GBXCKJPGSA-N |
| XLogP | 4.33 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.64 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|