C19H25NO2 — CID 15157378
1-(8-hydroxy-5,7-dimethyl-2,3,4,4a,9,9a-hexahydro-1H-fluoren-9-yl)pyrrolidin-2-one (PubChem CID 15157378) has the molecular formula C19H25NO2 and a molecular weight of 299.41 g/mol. Its IUPAC name is 1-(8-hydroxy-5,7-dimethyl-2,3,4,4a,9,9a-hexahydro-1H-fluoren-9-yl)pyrrolidin-2-one.
| Compound Name | 1-(8-hydroxy-5,7-dimethyl-2,3,4,4a,9,9a-hexahydro-1H-fluoren-9-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 15157378 |
| Molecular Formula | C19H25NO2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 1-(8-hydroxy-5,7-dimethyl-2,3,4,4a,9,9a-hexahydro-1H-fluoren-9-yl)pyrrolidin-2-one |
| SMILES | Cc1cc(C)c2c(c1O)C(N1CCCC1=O)C1CCCCC21 |
| InChI | InChI=1S/C19H25NO2/c1-11-10-12(2)19(22)17-16(11)13-6-3-4-7-14(13)18(17)20-9-5-8-15(20)21/h10,13-14,18,22H,3-9H2,1-2H3 |
| InChIKey | PTAYMWGTBUTORD-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|