About [3-[[ethyl-[5-(5-nitro-1,3-dioxoisoindol-2-yl)pentyl]amino]methyl]phenyl] N-methylcarbamate
[3-[[ethyl-[5-(5-nitro-1,3-dioxoisoindol-2-yl)pentyl]amino]methyl]phenyl] N-methylcarbamate (PubChem CID 15157517) has the molecular formula C24H28N4O6
and a molecular weight of 468.51 g/mol. Its IUPAC name is [3-[[ethyl-[5-(5-nitro-1,3-dioxoisoindol-2-yl)pentyl]amino]methyl]phenyl] N-methylcarbamate.
Molecular Properties
| Compound Name | [3-[[ethyl-[5-(5-nitro-1,3-dioxoisoindol-2-yl)pentyl]amino]methyl]phenyl] N-methylcarbamate |
| PubChem CID | 15157517 |
| Molecular Formula | C24H28N4O6 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | [3-[[ethyl-[5-(5-nitro-1,3-dioxoisoindol-2-yl)pentyl]amino]methyl]phenyl] N-methylcarbamate |
| SMILES | CCN(CCCCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)Cc1cccc(OC(=O)NC)c1 |
| InChI | InChI=1S/C24H28N4O6/c1-3-26(16-17-8-7-9-19(14-17)34-24(31)25-2)12-5-4-6-13-27-22(29)20-11-10-18(28(32)33)15-21(20)23(27)30/h7-11,14-15H,3-6,12-13,16H2,1-2H3,(H,25,31) |
| InChIKey | WLLAZGPHIJSNGO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze [3-[[ethyl-[5-(5-nitro-1,3-dioxoisoindol-2-yl)pentyl]amino]methyl]phenyl] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[ethyl-[5-(5-nitro-1,3-dioxoisoindol-2-yl)pentyl]amino]methyl]phenyl] N-methylcarbamate?
The IUPAC name of [3-[[ethyl-[5-(5-nitro-1,3-dioxoisoindol-2-yl)pentyl]amino]methyl]phenyl] N-methylcarbamate (CID 15157517) is [3-[[ethyl-[5-(5-nitro-1,3-dioxoisoindol-2-yl)pentyl]amino]methyl]phenyl] N-methylcarbamate.
What is the SMILES notation for [3-[[ethyl-[5-(5-nitro-1,3-dioxoisoindol-2-yl)pentyl]amino]methyl]phenyl] N-methylcarbamate?
The canonical SMILES for [3-[[ethyl-[5-(5-nitro-1,3-dioxoisoindol-2-yl)pentyl]amino]methyl]phenyl] N-methylcarbamate is CCN(CCCCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)Cc1cccc(OC(=O)NC)c1.
What is the InChIKey of [3-[[ethyl-[5-(5-nitro-1,3-dioxoisoindol-2-yl)pentyl]amino]methyl]phenyl] N-methylcarbamate?
The InChIKey is WLLAZGPHIJSNGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N4O6/c1-3-26(16-17-8-7-9-19(14-17)34-24(31)25-2)12-5-4-6-13-27-22(29)20-11-10-18(28(32)33)15-21(20)23(27)30/h7-11,14-15H,3-6,12-13,16H2,1-2H3,(H,25,31).
What are the key properties of [3-[[ethyl-[5-(5-nitro-1,3-dioxoisoindol-2-yl)pentyl]amino]methyl]phenyl] N-methylcarbamate?
[3-[[ethyl-[5-(5-nitro-1,3-dioxoisoindol-2-yl)pentyl]amino]methyl]phenyl] N-methylcarbamate has a molecular weight of 468.51 g/mol, XLogP of 3.60, 11 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[ethyl-[5-(5-nitro-1,3-dioxoisoindol-2-yl)pentyl]amino]methyl]phenyl] N-methylcarbamate is sourced from PubChem (CID 15157517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).