About 3-benzylidene-5,7-dibutoxy-4H-chromen-2-one
3-benzylidene-5,7-dibutoxy-4H-chromen-2-one (PubChem CID 151578027) has the molecular formula C24H28O4
and a molecular weight of 380.48 g/mol. Its IUPAC name is 3-benzylidene-5,7-dibutoxy-4H-chromen-2-one.
Molecular Properties
| Compound Name | 3-benzylidene-5,7-dibutoxy-4H-chromen-2-one |
| PubChem CID | 151578027 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 3-benzylidene-5,7-dibutoxy-4H-chromen-2-one |
| SMILES | CCCCOc1cc(OCCCC)c2c(c1)OC(=O)C(=Cc1ccccc1)C2 |
| InChI | InChI=1S/C24H28O4/c1-3-5-12-26-20-16-22(27-13-6-4-2)21-15-19(24(25)28-23(21)17-20)14-18-10-8-7-9-11-18/h7-11,14,16-17H,3-6,12-13,15H2,1-2H3 |
| InChIKey | QFWNSEYMSAOOIA-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-benzylidene-5,7-dibutoxy-4H-chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylidene-5,7-dibutoxy-4H-chromen-2-one?
The IUPAC name of 3-benzylidene-5,7-dibutoxy-4H-chromen-2-one (CID 151578027) is 3-benzylidene-5,7-dibutoxy-4H-chromen-2-one.
What is the SMILES notation for 3-benzylidene-5,7-dibutoxy-4H-chromen-2-one?
The canonical SMILES for 3-benzylidene-5,7-dibutoxy-4H-chromen-2-one is CCCCOc1cc(OCCCC)c2c(c1)OC(=O)C(=Cc1ccccc1)C2.
What is the InChIKey of 3-benzylidene-5,7-dibutoxy-4H-chromen-2-one?
The InChIKey is QFWNSEYMSAOOIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28O4/c1-3-5-12-26-20-16-22(27-13-6-4-2)21-15-19(24(25)28-23(21)17-20)14-18-10-8-7-9-11-18/h7-11,14,16-17H,3-6,12-13,15H2,1-2H3.
What are the key properties of 3-benzylidene-5,7-dibutoxy-4H-chromen-2-one?
3-benzylidene-5,7-dibutoxy-4H-chromen-2-one has a molecular weight of 380.48 g/mol, XLogP of 5.59, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylidene-5,7-dibutoxy-4H-chromen-2-one is sourced from PubChem (CID 151578027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).