C25H31FN6OS — CID 151581941
4-fluoro-6-(8-methoxy-2-methylimidazo[1,2-b]pyridazin-6-yl)-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-benzothiazol-2-amine (PubChem CID 151581941) has the molecular formula C25H31FN6OS and a molecular weight of 482.63 g/mol. Its IUPAC name is 4-fluoro-6-(8-methoxy-2-methylimidazo[1,2-b]pyridazin-6-yl)-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-benzothiazol-2-amine.
| Compound Name | 4-fluoro-6-(8-methoxy-2-methylimidazo[1,2-b]pyridazin-6-yl)-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 151581941 |
| Molecular Formula | C25H31FN6OS |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 4-fluoro-6-(8-methoxy-2-methylimidazo[1,2-b]pyridazin-6-yl)-N-methyl-N-(2,2,6,6-tetramethylpiperidin-4-yl)-1,3-benzothiazol-2-amine |
| SMILES | COc1cc(-c2cc(F)c3nc(N(C)C4CC(C)(C)NC(C)(C)C4)sc3c2)nn2cc(C)nc12 |
| InChI | InChI=1S/C25H31FN6OS/c1-14-13-32-22(27-14)19(33-7)10-18(29-32)15-8-17(26)21-20(9-15)34-23(28-21)31(6)16-11-24(2,3)30-25(4,5)12-16/h8-10,13,16,30H,11-12H2,1-7H3 |
| InChIKey | QGRKQGKWZJNVEU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |