C25H24F3N5O3S — CID 151582429
benzyl N-[(1S,3S,5R)-3-(1,3-oxazol-2-yl)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamate (PubChem CID 151582429) has the molecular formula C25H24F3N5O3S and a molecular weight of 531.56 g/mol. Its IUPAC name is benzyl N-[(1S,3S,5R)-3-(1,3-oxazol-2-yl)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamate.
| Compound Name | benzyl N-[(1S,3S,5R)-3-(1,3-oxazol-2-yl)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 151582429 |
| Molecular Formula | C25H24F3N5O3S |
| Molecular Weight | 531.56 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | benzyl N-[(1S,3S,5R)-3-(1,3-oxazol-2-yl)-5-[[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]amino]cyclohexyl]carbamate |
| SMILES | O=C(N[C@@H]1C[C@H](Nc2ncnc3sc(CC(F)(F)F)cc23)C[C@H](c2ncco2)C1)OCc1ccccc1 |
| InChI | InChI=1S/C25H24F3N5O3S/c26-25(27,28)12-19-11-20-21(30-14-31-23(20)37-19)32-17-8-16(22-29-6-7-35-22)9-18(10-17)33-24(34)36-13-15-4-2-1-3-5-15/h1-7,11,14,16-18H,8-10,12-13H2,(H,33,34)(H,30,31,32)/t16-,17+,18-/m0/s1 |
| InChIKey | QGTYRVCKJDDNKD-KSZLIROESA-N |
| XLogP | 5.83 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |