C10H8F5N — CID 151583537
6-(1,1,2,2,2-pentafluoroethyl)-6,7-dihydro-5H-indole (PubChem CID 151583537) has the molecular formula C10H8F5N and a molecular weight of 237.17 g/mol. Its IUPAC name is 6-(1,1,2,2,2-pentafluoroethyl)-6,7-dihydro-5H-indole.
| Compound Name | 6-(1,1,2,2,2-pentafluoroethyl)-6,7-dihydro-5H-indole |
|---|---|
| PubChem CID | 151583537 |
| Molecular Formula | C10H8F5N |
| Molecular Weight | 237.17 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 6-(1,1,2,2,2-pentafluoroethyl)-6,7-dihydro-5H-indole |
| SMILES | FC(F)(F)C(F)(F)C1CC=C2C=CN=C2C1 |
| InChI | InChI=1S/C10H8F5N/c11-9(12,10(13,14)15)7-2-1-6-3-4-16-8(6)5-7/h1,3-4,7H,2,5H2 |
| InChIKey | QGZORQARTYMOPU-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.17 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|