C14H17ClF4O — CID 151584403
1-chloro-4-[3,3-dimethyl-4-(1,1,2,2-tetrafluoroethoxy)butan-2-yl]benzene (PubChem CID 151584403) has the molecular formula C14H17ClF4O and a molecular weight of 312.73 g/mol. Its IUPAC name is 1-chloro-4-[3,3-dimethyl-4-(1,1,2,2-tetrafluoroethoxy)butan-2-yl]benzene.
| Compound Name | 1-chloro-4-[3,3-dimethyl-4-(1,1,2,2-tetrafluoroethoxy)butan-2-yl]benzene |
|---|---|
| PubChem CID | 151584403 |
| Molecular Formula | C14H17ClF4O |
| Molecular Weight | 312.73 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-chloro-4-[3,3-dimethyl-4-(1,1,2,2-tetrafluoroethoxy)butan-2-yl]benzene |
| SMILES | CC(c1ccc(Cl)cc1)C(C)(C)COC(F)(F)C(F)F |
| InChI | InChI=1S/C14H17ClF4O/c1-9(10-4-6-11(15)7-5-10)13(2,3)8-20-14(18,19)12(16)17/h4-7,9,12H,8H2,1-3H3 |
| InChIKey | QHEBYTPJYIJQFC-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.73 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|