C27H41N3O — CID 151587535
3-[5-(10,10-dimethylundecyl)-3-ethynyl-2-pyridinyl]-1-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d]imidazol-2-one (PubChem CID 151587535) has the molecular formula C27H41N3O and a molecular weight of 423.65 g/mol. Its IUPAC name is 3-[5-(10,10-dimethylundecyl)-3-ethynyl-2-pyridinyl]-1-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d]imidazol-2-one.
| Compound Name | 3-[5-(10,10-dimethylundecyl)-3-ethynyl-2-pyridinyl]-1-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d]imidazol-2-one |
|---|---|
| PubChem CID | 151587535 |
| Molecular Formula | C27H41N3O |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 423.32 |
| IUPAC Name | 3-[5-(10,10-dimethylundecyl)-3-ethynyl-2-pyridinyl]-1-methyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d]imidazol-2-one |
| SMILES | C#Cc1cc(CCCCCCCCCC(C)(C)C)cnc1N1C(=O)N(C)C2CCCC21 |
| InChI | InChI=1S/C27H41N3O/c1-6-22-19-21(15-12-10-8-7-9-11-13-18-27(2,3)4)20-28-25(22)30-24-17-14-16-23(24)29(5)26(30)31/h1,19-20,23-24H,7-18H2,2-5H3 |
| InChIKey | QHUQMMWIWCEDQS-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|