C26H52O4 — CID 151589959
1-(2-methylprop-2-enoxy)-4-[2,2,2-tri(propan-2-yloxy)ethyl]undecane (PubChem CID 151589959) has the molecular formula C26H52O4 and a molecular weight of 428.70 g/mol. Its IUPAC name is 1-(2-methylprop-2-enoxy)-4-[2,2,2-tri(propan-2-yloxy)ethyl]undecane.
| Compound Name | 1-(2-methylprop-2-enoxy)-4-[2,2,2-tri(propan-2-yloxy)ethyl]undecane |
|---|---|
| PubChem CID | 151589959 |
| Molecular Formula | C26H52O4 |
| Molecular Weight | 428.70 g/mol |
| Exact Mass | 428.39 |
| IUPAC Name | 1-(2-methylprop-2-enoxy)-4-[2,2,2-tri(propan-2-yloxy)ethyl]undecane |
| SMILES | C=C(C)COCCCC(CCCCCCC)CC(OC(C)C)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C26H52O4/c1-10-11-12-13-14-16-25(17-15-18-27-20-21(2)3)19-26(28-22(4)5,29-23(6)7)30-24(8)9/h22-25H,2,10-20H2,1,3-9H3 |
| InChIKey | QIHJUMWYNRJNGH-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.70 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|