About 4-[[2-(3,4-dichlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperidine
4-[[2-(3,4-dichlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperidine (PubChem CID 151591203) has the molecular formula C20H27Cl2N
and a molecular weight of 352.35 g/mol. Its IUPAC name is 4-[[2-(3,4-dichlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperidine.
Molecular Properties
| Compound Name | 4-[[2-(3,4-dichlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperidine |
| PubChem CID | 151591203 |
| Molecular Formula | C20H27Cl2N |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 4-[[2-(3,4-dichlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperidine |
| SMILES | CC1(C)CCC(CC2CCNCC2)=C(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C20H27Cl2N/c1-20(2)8-5-16(11-14-6-9-23-10-7-14)17(13-20)15-3-4-18(21)19(22)12-15/h3-4,12,14,23H,5-11,13H2,1-2H3 |
| InChIKey | QINQHWMBQDGCSY-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[[2-(3,4-dichlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-(3,4-dichlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperidine?
The IUPAC name of 4-[[2-(3,4-dichlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperidine (CID 151591203) is 4-[[2-(3,4-dichlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperidine.
What is the SMILES notation for 4-[[2-(3,4-dichlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperidine?
The canonical SMILES for 4-[[2-(3,4-dichlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperidine is CC1(C)CCC(CC2CCNCC2)=C(c2ccc(Cl)c(Cl)c2)C1.
What is the InChIKey of 4-[[2-(3,4-dichlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperidine?
The InChIKey is QINQHWMBQDGCSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27Cl2N/c1-20(2)8-5-16(11-14-6-9-23-10-7-14)17(13-20)15-3-4-18(21)19(22)12-15/h3-4,12,14,23H,5-11,13H2,1-2H3.
What are the key properties of 4-[[2-(3,4-dichlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperidine?
4-[[2-(3,4-dichlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperidine has a molecular weight of 352.35 g/mol, XLogP of 6.35, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-(3,4-dichlorophenyl)-4,4-dimethylcyclohexen-1-yl]methyl]piperidine is sourced from PubChem (CID 151591203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).