C14H24O — CID 151595685
3,4,4,5,6-pentamethyl-2-methylideneoct-6-enal (PubChem CID 151595685) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 3,4,4,5,6-pentamethyl-2-methylideneoct-6-enal.
| Compound Name | 3,4,4,5,6-pentamethyl-2-methylideneoct-6-enal |
|---|---|
| PubChem CID | 151595685 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 3,4,4,5,6-pentamethyl-2-methylideneoct-6-enal |
| SMILES | C=C(C=O)C(C)C(C)(C)C(C)C(C)=CC |
| InChI | InChI=1S/C14H24O/c1-8-10(2)12(4)14(6,7)13(5)11(3)9-15/h8-9,12-13H,3H2,1-2,4-7H3 |
| InChIKey | QJKPZKHALGMAFM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|