About 2-(2,5-dimethoxyphenyl)-2-(4-methanehydrazonoylanilino)acetic acid
2-(2,5-dimethoxyphenyl)-2-(4-methanehydrazonoylanilino)acetic acid (PubChem CID 151596409) has the molecular formula C17H19N3O4
and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-2-(4-methanehydrazonoylanilino)acetic acid.
Molecular Properties
| Compound Name | 2-(2,5-dimethoxyphenyl)-2-(4-methanehydrazonoylanilino)acetic acid |
| PubChem CID | 151596409 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-2-(4-methanehydrazonoylanilino)acetic acid |
| SMILES | COc1ccc(OC)c(C(Nc2ccc(C=NN)cc2)C(=O)O)c1 |
| InChI | InChI=1S/C17H19N3O4/c1-23-13-7-8-15(24-2)14(9-13)16(17(21)22)20-12-5-3-11(4-6-12)10-19-18/h3-10,16,20H,18H2,1-2H3,(H,21,22) |
| InChIKey | QJNZKQGFNVVEDK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,5-dimethoxyphenyl)-2-(4-methanehydrazonoylanilino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,5-dimethoxyphenyl)-2-(4-methanehydrazonoylanilino)acetic acid?
The IUPAC name of 2-(2,5-dimethoxyphenyl)-2-(4-methanehydrazonoylanilino)acetic acid (CID 151596409) is 2-(2,5-dimethoxyphenyl)-2-(4-methanehydrazonoylanilino)acetic acid.
What is the SMILES notation for 2-(2,5-dimethoxyphenyl)-2-(4-methanehydrazonoylanilino)acetic acid?
The canonical SMILES for 2-(2,5-dimethoxyphenyl)-2-(4-methanehydrazonoylanilino)acetic acid is COc1ccc(OC)c(C(Nc2ccc(C=NN)cc2)C(=O)O)c1.
What is the InChIKey of 2-(2,5-dimethoxyphenyl)-2-(4-methanehydrazonoylanilino)acetic acid?
The InChIKey is QJNZKQGFNVVEDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3O4/c1-23-13-7-8-15(24-2)14(9-13)16(17(21)22)20-12-5-3-11(4-6-12)10-19-18/h3-10,16,20H,18H2,1-2H3,(H,21,22).
What are the key properties of 2-(2,5-dimethoxyphenyl)-2-(4-methanehydrazonoylanilino)acetic acid?
2-(2,5-dimethoxyphenyl)-2-(4-methanehydrazonoylanilino)acetic acid has a molecular weight of 329.36 g/mol, XLogP of 2.23, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,5-dimethoxyphenyl)-2-(4-methanehydrazonoylanilino)acetic acid is sourced from PubChem (CID 151596409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).