About [5-(2-methylindazol-5-yl)-1,2-oxazol-3-yl]methanol
[5-(2-methylindazol-5-yl)-1,2-oxazol-3-yl]methanol (PubChem CID 151597822) has the molecular formula C12H11N3O2
and a molecular weight of 229.24 g/mol. Its IUPAC name is [5-(2-methylindazol-5-yl)-1,2-oxazol-3-yl]methanol.
Molecular Properties
| Compound Name | [5-(2-methylindazol-5-yl)-1,2-oxazol-3-yl]methanol |
| PubChem CID | 151597822 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | [5-(2-methylindazol-5-yl)-1,2-oxazol-3-yl]methanol |
| SMILES | Cn1cc2cc(-c3cc(CO)no3)ccc2n1 |
| InChI | InChI=1S/C12H11N3O2/c1-15-6-9-4-8(2-3-11(9)13-15)12-5-10(7-16)14-17-12/h2-6,16H,7H2,1H3 |
| InChIKey | QJVNQECOUYCNIL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [5-(2-methylindazol-5-yl)-1,2-oxazol-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-methylindazol-5-yl)-1,2-oxazol-3-yl]methanol?
The IUPAC name of [5-(2-methylindazol-5-yl)-1,2-oxazol-3-yl]methanol (CID 151597822) is [5-(2-methylindazol-5-yl)-1,2-oxazol-3-yl]methanol.
What is the SMILES notation for [5-(2-methylindazol-5-yl)-1,2-oxazol-3-yl]methanol?
The canonical SMILES for [5-(2-methylindazol-5-yl)-1,2-oxazol-3-yl]methanol is Cn1cc2cc(-c3cc(CO)no3)ccc2n1.
What is the InChIKey of [5-(2-methylindazol-5-yl)-1,2-oxazol-3-yl]methanol?
The InChIKey is QJVNQECOUYCNIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3O2/c1-15-6-9-4-8(2-3-11(9)13-15)12-5-10(7-16)14-17-12/h2-6,16H,7H2,1H3.
What are the key properties of [5-(2-methylindazol-5-yl)-1,2-oxazol-3-yl]methanol?
[5-(2-methylindazol-5-yl)-1,2-oxazol-3-yl]methanol has a molecular weight of 229.24 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-methylindazol-5-yl)-1,2-oxazol-3-yl]methanol is sourced from PubChem (CID 151597822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).